C18H18O3 — CID 174606516
2-hydroxy-4-phenyl-2-(2-phenylethyl)but-3-enoic acid (PubChem CID 174606516) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-hydroxy-4-phenyl-2-(2-phenylethyl)but-3-enoic acid.
| Compound Name | 2-hydroxy-4-phenyl-2-(2-phenylethyl)but-3-enoic acid |
|---|---|
| PubChem CID | 174606516 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-hydroxy-4-phenyl-2-(2-phenylethyl)but-3-enoic acid |
| SMILES | O=C(O)C(O)(C=Cc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C18H18O3/c19-17(20)18(21,13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-11,13,21H,12,14H2,(H,19,20) |
| InChIKey | ARWYSMAOPNGNIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |