C18H25NO2 — CID 101385570
2-hydroxy-2-[(E)-2-phenylethenyl]-1-piperidin-1-ylpentan-1-one (PubChem CID 101385570) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-hydroxy-2-[(E)-2-phenylethenyl]-1-piperidin-1-ylpentan-1-one.
| Compound Name | 2-hydroxy-2-[(E)-2-phenylethenyl]-1-piperidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 101385570 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-hydroxy-2-[(E)-2-phenylethenyl]-1-piperidin-1-ylpentan-1-one |
| SMILES | CCCC(O)(/C=C/c1ccccc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H25NO2/c1-2-12-18(21,13-11-16-9-5-3-6-10-16)17(20)19-14-7-4-8-15-19/h3,5-6,9-11,13,21H,2,4,7-8,12,14-15H2,1H3/b13-11+ |
| InChIKey | GREPOYJIGGOJSE-ACCUITESSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |