C25H31NO4 — CID 86754086
diethyl benzene-1,2-dicarboxylate;1-(2-phenylethenyl)piperidine (PubChem CID 86754086) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is diethyl benzene-1,2-dicarboxylate;1-(2-phenylethenyl)piperidine.
| Compound Name | diethyl benzene-1,2-dicarboxylate;1-(2-phenylethenyl)piperidine |
|---|---|
| PubChem CID | 86754086 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | diethyl benzene-1,2-dicarboxylate;1-(2-phenylethenyl)piperidine |
| SMILES | C(=CN1CCCCC1)c1ccccc1.CCOC(=O)c1ccccc1C(=O)OCC |
| InChI | InChI=1S/C13H17N.C12H14O4/c1-3-7-13(8-4-1)9-12-14-10-5-2-6-11-14;1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h1,3-4,7-9,12H,2,5-6,10-11H2;5-8H,3-4H2,1-2H3 |
| InChIKey | QUGKIHHMGNHGOG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |