C14H18Cl3NO4 — CID 122396426
2,2,2-trichloroethyl (2R)-4-methyl-2-(2-oxo-2-propan-2-yloxyethyl)-2H-pyridine-1-carboxylate (PubChem CID 122396426) has the molecular formula C14H18Cl3NO4 and a molecular weight of 370.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2R)-4-methyl-2-(2-oxo-2-propan-2-yloxyethyl)-2H-pyridine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (2R)-4-methyl-2-(2-oxo-2-propan-2-yloxyethyl)-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 122396426 |
| Molecular Formula | C14H18Cl3NO4 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2,2,2-trichloroethyl (2R)-4-methyl-2-(2-oxo-2-propan-2-yloxyethyl)-2H-pyridine-1-carboxylate |
| SMILES | CC1=C[C@@H](CC(=O)OC(C)C)N(C(=O)OCC(Cl)(Cl)Cl)C=C1 |
| InChI | InChI=1S/C14H18Cl3NO4/c1-9(2)22-12(19)7-11-6-10(3)4-5-18(11)13(20)21-8-14(15,16)17/h4-6,9,11H,7-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | XIGAWQWTFXQTFS-NSHDSACASA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|