C13H18Cl3NO4 — CID 56978242
2-O-ethyl 1-O-(2,2,2-trichloroethyl) (2R)-4-ethyl-3,6-dihydro-2H-pyridine-1,2-dicarboxylate (PubChem CID 56978242) has the molecular formula C13H18Cl3NO4 and a molecular weight of 358.65 g/mol. Its IUPAC name is 2-O-ethyl 1-O-(2,2,2-trichloroethyl) (2R)-4-ethyl-3,6-dihydro-2H-pyridine-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-(2,2,2-trichloroethyl) (2R)-4-ethyl-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 56978242 |
| Molecular Formula | C13H18Cl3NO4 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-O-ethyl 1-O-(2,2,2-trichloroethyl) (2R)-4-ethyl-3,6-dihydro-2H-pyridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(CC)=CCN1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl3NO4/c1-3-9-5-6-17(10(7-9)11(18)20-4-2)12(19)21-8-13(14,15)16/h5,10H,3-4,6-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | NKALIPOJATWOIW-SNVBAGLBSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|