About 2-methyl-6,7-dihydro-5H-indolizin-3-one
2-methyl-6,7-dihydro-5H-indolizin-3-one (PubChem CID 122397881) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-5H-indolizin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6,7-dihydro-5H-indolizin-3-one |
| PubChem CID | 122397881 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-methyl-6,7-dihydro-5H-indolizin-3-one |
| SMILES | CC1=CC2=CCCCN2C1=O |
| InChI | InChI=1S/C9H11NO/c1-7-6-8-4-2-3-5-10(8)9(7)11/h4,6H,2-3,5H2,1H3 |
| InChIKey | WURKYBOEJYLVIY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-6,7-dihydro-5H-indolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dihydro-5H-indolizin-3-one?
The IUPAC name of 2-methyl-6,7-dihydro-5H-indolizin-3-one (CID 122397881) is 2-methyl-6,7-dihydro-5H-indolizin-3-one.
What is the SMILES notation for 2-methyl-6,7-dihydro-5H-indolizin-3-one?
The canonical SMILES for 2-methyl-6,7-dihydro-5H-indolizin-3-one is CC1=CC2=CCCCN2C1=O.
What is the InChIKey of 2-methyl-6,7-dihydro-5H-indolizin-3-one?
The InChIKey is WURKYBOEJYLVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-7-6-8-4-2-3-5-10(8)9(7)11/h4,6H,2-3,5H2,1H3.
What are the key properties of 2-methyl-6,7-dihydro-5H-indolizin-3-one?
2-methyl-6,7-dihydro-5H-indolizin-3-one has a molecular weight of 149.19 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydro-5H-indolizin-3-one is sourced from PubChem (CID 122397881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).