C10H12FNO — CID 122633271
1-fluoro-6,8-dimethyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 122633271) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 1-fluoro-6,8-dimethyl-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 1-fluoro-6,8-dimethyl-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 122633271 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-fluoro-6,8-dimethyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | Cc1cc(C)c(=O)n2c1C(F)CC2 |
| InChI | InChI=1S/C10H12FNO/c1-6-5-7(2)10(13)12-4-3-8(11)9(6)12/h5,8H,3-4H2,1-2H3 |
| InChIKey | JEEGVSRCARXQCC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |