C17H15Cl3O — CID 122398101
2,2,4-trichloro-4-(2-methylphenyl)-1-phenylbutan-1-one (PubChem CID 122398101) has the molecular formula C17H15Cl3O and a molecular weight of 341.67 g/mol. Its IUPAC name is 2,2,4-trichloro-4-(2-methylphenyl)-1-phenylbutan-1-one.
| Compound Name | 2,2,4-trichloro-4-(2-methylphenyl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 122398101 |
| Molecular Formula | C17H15Cl3O |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2,2,4-trichloro-4-(2-methylphenyl)-1-phenylbutan-1-one |
| SMILES | Cc1ccccc1C(Cl)CC(Cl)(Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl3O/c1-12-7-5-6-10-14(12)15(18)11-17(19,20)16(21)13-8-3-2-4-9-13/h2-10,15H,11H2,1H3 |
| InChIKey | GUMLMVUXPIJQAF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|