C15H22O6 — CID 122398116
(E,2S,3S,4R,5R)-7-[2-(hydroxymethyl)-3-methoxyphenyl]hept-6-ene-2,3,4,5-tetrol (PubChem CID 122398116) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E,2S,3S,4R,5R)-7-[2-(hydroxymethyl)-3-methoxyphenyl]hept-6-ene-2,3,4,5-tetrol.
| Compound Name | (E,2S,3S,4R,5R)-7-[2-(hydroxymethyl)-3-methoxyphenyl]hept-6-ene-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 122398116 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (E,2S,3S,4R,5R)-7-[2-(hydroxymethyl)-3-methoxyphenyl]hept-6-ene-2,3,4,5-tetrol |
| SMILES | COc1cccc(/C=C/[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O)c1CO |
| InChI | InChI=1S/C15H22O6/c1-9(17)14(19)15(20)12(18)7-6-10-4-3-5-13(21-2)11(10)8-16/h3-7,9,12,14-20H,8H2,1-2H3/b7-6+/t9-,12+,14-,15+/m0/s1 |
| InChIKey | XAUKEFNFVZJJRQ-DHAMEPLPSA-N |
| XLogP | -0.34 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |