C14H17NO6S — CID 122398667
methyl (E)-3-[(2-methoxy-2-oxoethyl)-(4-methylphenyl)sulfonylamino]prop-2-enoate (PubChem CID 122398667) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is methyl (E)-3-[(2-methoxy-2-oxoethyl)-(4-methylphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2-methoxy-2-oxoethyl)-(4-methylphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 122398667 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | methyl (E)-3-[(2-methoxy-2-oxoethyl)-(4-methylphenyl)sulfonylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/N(CC(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17NO6S/c1-11-4-6-12(7-5-11)22(18,19)15(10-14(17)21-3)9-8-13(16)20-2/h4-9H,10H2,1-3H3/b9-8+ |
| InChIKey | HTTRBRAAOCLRTD-CMDGGOBGSA-N |
| XLogP | 0.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|