C17H23NO6S — CID 102297277
methyl (E)-3-[2-[(2S,3S)-3-[(1S)-1-hydroxyethyl]oxiran-2-yl]ethyl-(4-methylphenyl)sulfonylamino]prop-2-enoate (PubChem CID 102297277) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl (E)-3-[2-[(2S,3S)-3-[(1S)-1-hydroxyethyl]oxiran-2-yl]ethyl-(4-methylphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(2S,3S)-3-[(1S)-1-hydroxyethyl]oxiran-2-yl]ethyl-(4-methylphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 102297277 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl (E)-3-[2-[(2S,3S)-3-[(1S)-1-hydroxyethyl]oxiran-2-yl]ethyl-(4-methylphenyl)sulfonylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/N(CC[C@@H]1O[C@H]1[C@H](C)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-12-4-6-14(7-5-12)25(21,22)18(11-9-16(20)23-3)10-8-15-17(24-15)13(2)19/h4-7,9,11,13,15,17,19H,8,10H2,1-3H3/b11-9+/t13-,15-,17-/m0/s1 |
| InChIKey | NMVJOGSAQJAVJB-OMSJHEHNSA-N |
| XLogP | 1.21 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|