C19H25NO3 — CID 122399337
(E)-7-(1-benzyl-2-oxopiperidin-3-yl)hept-2-enoic acid (PubChem CID 122399337) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (E)-7-(1-benzyl-2-oxopiperidin-3-yl)hept-2-enoic acid.
| Compound Name | (E)-7-(1-benzyl-2-oxopiperidin-3-yl)hept-2-enoic acid |
|---|---|
| PubChem CID | 122399337 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (E)-7-(1-benzyl-2-oxopiperidin-3-yl)hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCCC1CCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H25NO3/c21-18(22)13-7-2-1-6-11-17-12-8-14-20(19(17)23)15-16-9-4-3-5-10-16/h3-5,7,9-10,13,17H,1-2,6,8,11-12,14-15H2,(H,21,22)/b13-7+ |
| InChIKey | OHRQPKIXASICNY-NTUHNPAUSA-N |
| XLogP | 3.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|