C20H28O2S2 — CID 70399594
7-[(3R,4S)-4-(2-benzylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid (PubChem CID 70399594) has the molecular formula C20H28O2S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(2-benzylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid.
| Compound Name | 7-[(3R,4S)-4-(2-benzylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 70399594 |
| Molecular Formula | C20H28O2S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 7-[(3R,4S)-4-(2-benzylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid |
| SMILES | O=C(O)C=CCCCC[C@H]1CSC[C@H]1CCSCc1ccccc1 |
| InChI | InChI=1S/C20H28O2S2/c21-20(22)11-7-2-1-6-10-18-15-24-16-19(18)12-13-23-14-17-8-4-3-5-9-17/h3-5,7-9,11,18-19H,1-2,6,10,12-16H2,(H,21,22)/t18-,19+/m0/s1 |
| InChIKey | YTQUZSGEXRZJCK-RBUKOAKNSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|