C15H21NO3S — CID 66855799
(3S,4R)-3-(3-benzylsulfanylpropyl)-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 66855799) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is (3S,4R)-3-(3-benzylsulfanylpropyl)-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (3S,4R)-3-(3-benzylsulfanylpropyl)-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66855799 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3S,4R)-3-(3-benzylsulfanylpropyl)-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](CCCSCc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C15H21NO3S/c17-14-10-16(15(18)19)9-13(14)7-4-8-20-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-11H2,(H,18,19)/t13-,14-/m0/s1 |
| InChIKey | MFJFGOMVZMCPJJ-KBPBESRZSA-N |
| XLogP | 2.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|