C17H28O2S2 — CID 70399686
(E)-7-[4-[2-(cyclopropylmethylsulfanyl)ethyl]thiolan-3-yl]hept-2-enoic acid (PubChem CID 70399686) has the molecular formula C17H28O2S2 and a molecular weight of 328.54 g/mol. Its IUPAC name is (E)-7-[4-[2-(cyclopropylmethylsulfanyl)ethyl]thiolan-3-yl]hept-2-enoic acid.
| Compound Name | (E)-7-[4-[2-(cyclopropylmethylsulfanyl)ethyl]thiolan-3-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 70399686 |
| Molecular Formula | C17H28O2S2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (E)-7-[4-[2-(cyclopropylmethylsulfanyl)ethyl]thiolan-3-yl]hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCCC1CSCC1CCSCC1CC1 |
| InChI | InChI=1S/C17H28O2S2/c18-17(19)6-4-2-1-3-5-15-12-21-13-16(15)9-10-20-11-14-7-8-14/h4,6,14-16H,1-3,5,7-13H2,(H,18,19)/b6-4+ |
| InChIKey | QYIWCTZGKOJKTB-GQCTYLIASA-N |
| XLogP | 4.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|