C19H26O2S2 — CID 70400218
(E)-7-[4-(2-phenylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid (PubChem CID 70400218) has the molecular formula C19H26O2S2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (E)-7-[4-(2-phenylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid.
| Compound Name | (E)-7-[4-(2-phenylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 70400218 |
| Molecular Formula | C19H26O2S2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (E)-7-[4-(2-phenylsulfanylethyl)thiolan-3-yl]hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCCC1CSCC1CCSc1ccccc1 |
| InChI | InChI=1S/C19H26O2S2/c20-19(21)11-7-2-1-4-8-16-14-22-15-17(16)12-13-23-18-9-5-3-6-10-18/h3,5-7,9-11,16-17H,1-2,4,8,12-15H2,(H,20,21)/b11-7+ |
| InChIKey | VEXXLKPXNWYFPJ-YRNVUSSQSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|