C23H32N2O6 — CID 122399604
tert-butyl (1R,2R,6R,8R,12S)-14-benzyl-4,4-dimethyl-3,5,7,13-tetraoxa-10,14-diazatetracyclo[10.2.1.01,8.02,6]pentadecane-10-carboxylate (PubChem CID 122399604) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl (1R,2R,6R,8R,12S)-14-benzyl-4,4-dimethyl-3,5,7,13-tetraoxa-10,14-diazatetracyclo[10.2.1.01,8.02,6]pentadecane-10-carboxylate.
| Compound Name | tert-butyl (1R,2R,6R,8R,12S)-14-benzyl-4,4-dimethyl-3,5,7,13-tetraoxa-10,14-diazatetracyclo[10.2.1.01,8.02,6]pentadecane-10-carboxylate |
|---|---|
| PubChem CID | 122399604 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl (1R,2R,6R,8R,12S)-14-benzyl-4,4-dimethyl-3,5,7,13-tetraoxa-10,14-diazatetracyclo[10.2.1.01,8.02,6]pentadecane-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@]3([C@@H](C1)O[C@@H]1OC(C)(C)O[C@@H]13)N(Cc1ccccc1)O2 |
| InChI | InChI=1S/C23H32N2O6/c1-21(2,3)30-20(26)24-13-16-11-23(25(31-16)12-15-9-7-6-8-10-15)17(14-24)27-19-18(23)28-22(4,5)29-19/h6-10,16-19H,11-14H2,1-5H3/t16-,17+,18-,19+,23+/m0/s1 |
| InChIKey | CLUIGMPUTMCWCO-CPXLJBANSA-N |
| XLogP | 3.06 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |