C11H5NO3S — CID 122400349
5-hydroxybenzo[f][1,2]benzothiazole-4,9-dione (PubChem CID 122400349) has the molecular formula C11H5NO3S and a molecular weight of 231.23 g/mol. Its IUPAC name is 5-hydroxybenzo[f][1,2]benzothiazole-4,9-dione.
| Compound Name | 5-hydroxybenzo[f][1,2]benzothiazole-4,9-dione |
|---|---|
| PubChem CID | 122400349 |
| Molecular Formula | C11H5NO3S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 5-hydroxybenzo[f][1,2]benzothiazole-4,9-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2cnsc21 |
| InChI | InChI=1S/C11H5NO3S/c13-7-3-1-2-5-8(7)9(14)6-4-12-16-11(6)10(5)15/h1-4,13H |
| InChIKey | SWEMXOONIVASEH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|