C19H27NO4 — CID 122400531
tert-butyl (1S)-6,8-dimethoxy-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 122400531) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl (1S)-6,8-dimethoxy-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1S)-6,8-dimethoxy-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 122400531 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl (1S)-6,8-dimethoxy-1-[(E)-prop-1-enyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C/C=C/[C@H]1c2c(cc(OC)cc2OC)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO4/c1-7-8-15-17-13(11-14(22-5)12-16(17)23-6)9-10-20(15)18(21)24-19(2,3)4/h7-8,11-12,15H,9-10H2,1-6H3/b8-7+/t15-/m0/s1 |
| InChIKey | BJPNXHYCWZOJOI-KIUWMYQTSA-N |
| XLogP | 4.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|