C17H34O7S — CID 122401894
2-(11-sulfanylundecoxymethoxymethoxymethoxymethoxy)acetic acid (PubChem CID 122401894) has the molecular formula C17H34O7S and a molecular weight of 382.52 g/mol. Its IUPAC name is 2-(11-sulfanylundecoxymethoxymethoxymethoxymethoxy)acetic acid.
| Compound Name | 2-(11-sulfanylundecoxymethoxymethoxymethoxymethoxy)acetic acid |
|---|---|
| PubChem CID | 122401894 |
| Molecular Formula | C17H34O7S |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-(11-sulfanylundecoxymethoxymethoxymethoxymethoxy)acetic acid |
| SMILES | O=C(O)COCOCOCOCOCCCCCCCCCCCS |
| InChI | InChI=1S/C17H34O7S/c18-17(19)12-21-14-23-16-24-15-22-13-20-10-8-6-4-2-1-3-5-7-9-11-25/h25H,1-16H2,(H,18,19) |
| InChIKey | YLRMUCMFTMVURR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|