C31H32ClIN2O4 — CID 122402150
tert-butyl 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-1,9-dioxo-4,6,8,10-tetrahydro-3H-benzo[b][1,6]naphthyridine-2-carboxylate (PubChem CID 122402150) has the molecular formula C31H32ClIN2O4 and a molecular weight of 658.96 g/mol. Its IUPAC name is tert-butyl 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-1,9-dioxo-4,6,8,10-tetrahydro-3H-benzo[b][1,6]naphthyridine-2-carboxylate.
| Compound Name | tert-butyl 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-1,9-dioxo-4,6,8,10-tetrahydro-3H-benzo[b][1,6]naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 122402150 |
| Molecular Formula | C31H32ClIN2O4 |
| Molecular Weight | 658.96 g/mol |
| Exact Mass | 658.11 |
| IUPAC Name | tert-butyl 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-1,9-dioxo-4,6,8,10-tetrahydro-3H-benzo[b][1,6]naphthyridine-2-carboxylate |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(I)cc1)C1=C(C(=O)N(C(=O)OC(C)(C)C)CC1)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H32ClIN2O4/c1-30(2,3)39-29(38)34-15-14-22-27(28(34)37)25(18-6-8-19(32)9-7-18)26-23(16-31(4,5)17-24(26)36)35(22)21-12-10-20(33)11-13-21/h6-13,25H,14-17H2,1-5H3 |
| InChIKey | JRFGXAVDMKBLGT-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.96 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|