C14H20OSi — CID 122403652
ethoxy-dimethyl-[(1E,3E)-4-phenylbuta-1,3-dienyl]silane (PubChem CID 122403652) has the molecular formula C14H20OSi and a molecular weight of 232.40 g/mol. Its IUPAC name is ethoxy-dimethyl-[(1E,3E)-4-phenylbuta-1,3-dienyl]silane.
| Compound Name | ethoxy-dimethyl-[(1E,3E)-4-phenylbuta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 122403652 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | ethoxy-dimethyl-[(1E,3E)-4-phenylbuta-1,3-dienyl]silane |
| SMILES | CCO[Si](C)(C)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H20OSi/c1-4-15-16(2,3)13-9-8-12-14-10-6-5-7-11-14/h5-13H,4H2,1-3H3/b12-8+,13-9+ |
| InChIKey | QFHPSPPCGRLAMY-QHKWOANTSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|