C23H21F3N2O5 — CID 122403707
diethyl (2R)-1'-methyl-2'-oxo-5'-(trifluoromethyl)spiro[1H-indole-2,3'-indole]-3,3-dicarboxylate (PubChem CID 122403707) has the molecular formula C23H21F3N2O5 and a molecular weight of 462.42 g/mol. Its IUPAC name is diethyl (2R)-1'-methyl-2'-oxo-5'-(trifluoromethyl)spiro[1H-indole-2,3'-indole]-3,3-dicarboxylate.
| Compound Name | diethyl (2R)-1'-methyl-2'-oxo-5'-(trifluoromethyl)spiro[1H-indole-2,3'-indole]-3,3-dicarboxylate |
|---|---|
| PubChem CID | 122403707 |
| Molecular Formula | C23H21F3N2O5 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | diethyl (2R)-1'-methyl-2'-oxo-5'-(trifluoromethyl)spiro[1H-indole-2,3'-indole]-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2N[C@@]12C(=O)N(C)c1ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C23H21F3N2O5/c1-4-32-19(30)21(20(31)33-5-2)14-8-6-7-9-16(14)27-22(21)15-12-13(23(24,25)26)10-11-17(15)28(3)18(22)29/h6-12,27H,4-5H2,1-3H3/t22-/m0/s1 |
| InChIKey | MZZRCBBZCMKIEW-QFIPXVFZSA-N |
| XLogP | 3.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|