About CID 122408815
CID 122408815 (PubChem CID 122408815) has the molecular formula C12H10BF9N
and a molecular weight of 350.01 g/mol.
Molecular Properties
| Compound Name | CID 122408815 |
| PubChem CID | 122408815 |
| Molecular Formula | C12H10BF9N |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccccc1[B]C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10BF9N/c1-23(2)8-6-4-3-5-7(8)13-9(10(14,15)16,11(17,18)19)12(20,21)22/h3-6H,1-2H3 |
| InChIKey | NRBJNFPJAXGFFM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 122408815 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122408815?
The IUPAC name of CID 122408815 (CID 122408815) is not available.
What is the SMILES notation for CID 122408815?
The canonical SMILES for CID 122408815 is CN(C)c1ccccc1[B]C(C(F)(F)F)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of CID 122408815?
The InChIKey is NRBJNFPJAXGFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BF9N/c1-23(2)8-6-4-3-5-7(8)13-9(10(14,15)16,11(17,18)19)12(20,21)22/h3-6H,1-2H3.
What are the key properties of CID 122408815?
CID 122408815 has a molecular weight of 350.01 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122408815 is sourced from PubChem (CID 122408815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).