C27H21NO — CID 122413989
16-tert-butyl-17-methylidene-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-15-one (PubChem CID 122413989) has the molecular formula C27H21NO and a molecular weight of 375.47 g/mol. Its IUPAC name is 16-tert-butyl-17-methylidene-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-15-one.
| Compound Name | 16-tert-butyl-17-methylidene-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-15-one |
|---|---|
| PubChem CID | 122413989 |
| Molecular Formula | C27H21NO |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 16-tert-butyl-17-methylidene-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaen-15-one |
| SMILES | C=c1c2ccc3c4cccc5cccc(c6ccc(c(=O)n1C(C)(C)C)c2c36)c54 |
| InChI | InChI=1S/C27H21NO/c1-15-17-11-12-20-18-9-5-7-16-8-6-10-19(23(16)18)21-13-14-22(24(17)25(20)21)26(29)28(15)27(2,3)4/h5-14H,1H2,2-4H3 |
| InChIKey | WPBYOLMDHQJOAJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|