C14H18N2O2 — CID 122415278
2-[[(2S)-1-cyano-3-(4-methylphenyl)propan-2-yl]-methylamino]acetic acid (PubChem CID 122415278) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[[(2S)-1-cyano-3-(4-methylphenyl)propan-2-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(2S)-1-cyano-3-(4-methylphenyl)propan-2-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122415278 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[[(2S)-1-cyano-3-(4-methylphenyl)propan-2-yl]-methylamino]acetic acid |
| SMILES | Cc1ccc(C[C@@H](CC#N)N(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-11-3-5-12(6-4-11)9-13(7-8-15)16(2)10-14(17)18/h3-6,13H,7,9-10H2,1-2H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | BUVDZGYYPGFJBU-CYBMUJFWSA-N |
| XLogP | 1.84 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |