C22H35N3O — CID 122417522
4-ethyl-N-(1-methylpiperidin-4-yl)-4-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 122417522) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is 4-ethyl-N-(1-methylpiperidin-4-yl)-4-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | 4-ethyl-N-(1-methylpiperidin-4-yl)-4-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122417522 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 4-ethyl-N-(1-methylpiperidin-4-yl)-4-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | CCC1(CCc2ccccc2)CCN(C(=O)NC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C22H35N3O/c1-3-22(12-9-19-7-5-4-6-8-19)13-17-25(18-14-22)21(26)23-20-10-15-24(2)16-11-20/h4-8,20H,3,9-18H2,1-2H3,(H,23,26) |
| InChIKey | GXPBNSSPLHWMEF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |