C24H17N3O6 — CID 122417902
3-N-(furan-2-yl)-4-(4-nitrophenoxy)-1-N-phenylbenzene-1,3-dicarboxamide (PubChem CID 122417902) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is 3-N-(furan-2-yl)-4-(4-nitrophenoxy)-1-N-phenylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(furan-2-yl)-4-(4-nitrophenoxy)-1-N-phenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 122417902 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-N-(furan-2-yl)-4-(4-nitrophenoxy)-1-N-phenylbenzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(Oc2ccc([N+](=O)[O-])cc2)c(C(=O)Nc2ccco2)c1 |
| InChI | InChI=1S/C24H17N3O6/c28-23(25-17-5-2-1-3-6-17)16-8-13-21(33-19-11-9-18(10-12-19)27(30)31)20(15-16)24(29)26-22-7-4-14-32-22/h1-15H,(H,25,28)(H,26,29) |
| InChIKey | WWIGBBCXDWGYJO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|