C28H29NO3S — CID 122422057
(1R)-1-(3-methoxyphenyl)-N-[1-[4-(4-methylsulfonylphenyl)naphthalen-2-yl]ethyl]ethanamine (PubChem CID 122422057) has the molecular formula C28H29NO3S and a molecular weight of 459.61 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N-[1-[4-(4-methylsulfonylphenyl)naphthalen-2-yl]ethyl]ethanamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N-[1-[4-(4-methylsulfonylphenyl)naphthalen-2-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 122422057 |
| Molecular Formula | C28H29NO3S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N-[1-[4-(4-methylsulfonylphenyl)naphthalen-2-yl]ethyl]ethanamine |
| SMILES | COc1cccc([C@@H](C)NC(C)c2cc(-c3ccc(S(C)(=O)=O)cc3)c3ccccc3c2)c1 |
| InChI | InChI=1S/C28H29NO3S/c1-19(22-9-7-10-25(17-22)32-3)29-20(2)24-16-23-8-5-6-11-27(23)28(18-24)21-12-14-26(15-13-21)33(4,30)31/h5-20,29H,1-4H3/t19-,20?/m1/s1 |
| InChIKey | FZBURZXTHPQQBY-FIWHBWSRSA-N |
| XLogP | 6.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |