C15H16ClN5O — CID 122423281
N-(5-amino-6-chloro-4-methyl-3-pyridinyl)-2-(cyclopropylamino)pyridine-3-carboxamide (PubChem CID 122423281) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(5-amino-6-chloro-4-methyl-3-pyridinyl)-2-(cyclopropylamino)pyridine-3-carboxamide.
| Compound Name | N-(5-amino-6-chloro-4-methyl-3-pyridinyl)-2-(cyclopropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122423281 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-(5-amino-6-chloro-4-methyl-3-pyridinyl)-2-(cyclopropylamino)pyridine-3-carboxamide |
| SMILES | Cc1c(NC(=O)c2cccnc2NC2CC2)cnc(Cl)c1N |
| InChI | InChI=1S/C15H16ClN5O/c1-8-11(7-19-13(16)12(8)17)21-15(22)10-3-2-6-18-14(10)20-9-4-5-9/h2-3,6-7,9H,4-5,17H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | NQDAMZVERYOVEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|