About heptan-2-yl 6-oxopyran-3-carboxylate
heptan-2-yl 6-oxopyran-3-carboxylate (PubChem CID 122423288) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is heptan-2-yl 6-oxopyran-3-carboxylate.
Molecular Properties
| Compound Name | heptan-2-yl 6-oxopyran-3-carboxylate |
| PubChem CID | 122423288 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | heptan-2-yl 6-oxopyran-3-carboxylate |
| SMILES | CCCCCC(C)OC(=O)c1ccc(=O)oc1 |
| InChI | InChI=1S/C13H18O4/c1-3-4-5-6-10(2)17-13(15)11-7-8-12(14)16-9-11/h7-10H,3-6H2,1-2H3 |
| InChIKey | YDGJAPKRXCOMSK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 6-oxopyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 6-oxopyran-3-carboxylate?
The IUPAC name of heptan-2-yl 6-oxopyran-3-carboxylate (CID 122423288) is heptan-2-yl 6-oxopyran-3-carboxylate.
What is the SMILES notation for heptan-2-yl 6-oxopyran-3-carboxylate?
The canonical SMILES for heptan-2-yl 6-oxopyran-3-carboxylate is CCCCCC(C)OC(=O)c1ccc(=O)oc1.
What is the InChIKey of heptan-2-yl 6-oxopyran-3-carboxylate?
The InChIKey is YDGJAPKRXCOMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-3-4-5-6-10(2)17-13(15)11-7-8-12(14)16-9-11/h7-10H,3-6H2,1-2H3.
What are the key properties of heptan-2-yl 6-oxopyran-3-carboxylate?
heptan-2-yl 6-oxopyran-3-carboxylate has a molecular weight of 238.28 g/mol, XLogP of 2.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 6-oxopyran-3-carboxylate is sourced from PubChem (CID 122423288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).