C23H24N4O3 — CID 122424675
1-[(3S,4R)-1-(2-methoxyacetyl)-4-phenylpyrrolidin-3-yl]-3-quinolin-3-ylurea (PubChem CID 122424675) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[(3S,4R)-1-(2-methoxyacetyl)-4-phenylpyrrolidin-3-yl]-3-quinolin-3-ylurea.
| Compound Name | 1-[(3S,4R)-1-(2-methoxyacetyl)-4-phenylpyrrolidin-3-yl]-3-quinolin-3-ylurea |
|---|---|
| PubChem CID | 122424675 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[(3S,4R)-1-(2-methoxyacetyl)-4-phenylpyrrolidin-3-yl]-3-quinolin-3-ylurea |
| SMILES | COCC(=O)N1C[C@@H](NC(=O)Nc2cnc3ccccc3c2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H24N4O3/c1-30-15-22(28)27-13-19(16-7-3-2-4-8-16)21(14-27)26-23(29)25-18-11-17-9-5-6-10-20(17)24-12-18/h2-12,19,21H,13-15H2,1H3,(H2,25,26,29)/t19-,21+/m0/s1 |
| InChIKey | NJDCWRSNKYGITK-PZJWPPBQSA-N |
| XLogP | 3.00 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |