C18H13ClFNO4S — CID 122424866
3-[1-(carboxymethyl)-6-chloro-7-fluoro-2-methylindol-3-yl]sulfanylbenzoic acid (PubChem CID 122424866) has the molecular formula C18H13ClFNO4S and a molecular weight of 393.82 g/mol. Its IUPAC name is 3-[1-(carboxymethyl)-6-chloro-7-fluoro-2-methylindol-3-yl]sulfanylbenzoic acid.
| Compound Name | 3-[1-(carboxymethyl)-6-chloro-7-fluoro-2-methylindol-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 122424866 |
| Molecular Formula | C18H13ClFNO4S |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 3-[1-(carboxymethyl)-6-chloro-7-fluoro-2-methylindol-3-yl]sulfanylbenzoic acid |
| SMILES | Cc1c(Sc2cccc(C(=O)O)c2)c2ccc(Cl)c(F)c2n1CC(=O)O |
| InChI | InChI=1S/C18H13ClFNO4S/c1-9-17(26-11-4-2-3-10(7-11)18(24)25)12-5-6-13(19)15(20)16(12)21(9)8-14(22)23/h2-7H,8H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | BFZCTXUEVQDFLM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |