C21H19ClFN3S — CID 141328510
6-chloro-7-fluoro-2-methyl-3-phenylsulfanyl-1-(1-propan-2-ylpyrazol-4-yl)indole (PubChem CID 141328510) has the molecular formula C21H19ClFN3S and a molecular weight of 399.92 g/mol. Its IUPAC name is 6-chloro-7-fluoro-2-methyl-3-phenylsulfanyl-1-(1-propan-2-ylpyrazol-4-yl)indole.
| Compound Name | 6-chloro-7-fluoro-2-methyl-3-phenylsulfanyl-1-(1-propan-2-ylpyrazol-4-yl)indole |
|---|---|
| PubChem CID | 141328510 |
| Molecular Formula | C21H19ClFN3S |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 6-chloro-7-fluoro-2-methyl-3-phenylsulfanyl-1-(1-propan-2-ylpyrazol-4-yl)indole |
| SMILES | Cc1c(Sc2ccccc2)c2ccc(Cl)c(F)c2n1-c1cnn(C(C)C)c1 |
| InChI | InChI=1S/C21H19ClFN3S/c1-13(2)25-12-15(11-24-25)26-14(3)21(27-16-7-5-4-6-8-16)17-9-10-18(22)19(23)20(17)26/h4-13H,1-3H3 |
| InChIKey | DRQIHSPFCALECB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |