C27H22ClF2N5OS — CID 130458276
3-[6-chloro-1-(1-ethylpyrazol-4-yl)-7-fluoro-2-methylindol-3-yl]sulfanyl-2-fluoro-N'-phenylbenzohydrazide (PubChem CID 130458276) has the molecular formula C27H22ClF2N5OS and a molecular weight of 538.02 g/mol. Its IUPAC name is 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-7-fluoro-2-methylindol-3-yl]sulfanyl-2-fluoro-N'-phenylbenzohydrazide.
| Compound Name | 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-7-fluoro-2-methylindol-3-yl]sulfanyl-2-fluoro-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 130458276 |
| Molecular Formula | C27H22ClF2N5OS |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 3-[6-chloro-1-(1-ethylpyrazol-4-yl)-7-fluoro-2-methylindol-3-yl]sulfanyl-2-fluoro-N'-phenylbenzohydrazide |
| SMILES | CCn1cc(-n2c(C)c(Sc3cccc(C(=O)NNc4ccccc4)c3F)c3ccc(Cl)c(F)c32)cn1 |
| InChI | InChI=1S/C27H22ClF2N5OS/c1-3-34-15-18(14-31-34)35-16(2)26(20-12-13-21(28)24(30)25(20)35)37-22-11-7-10-19(23(22)29)27(36)33-32-17-8-5-4-6-9-17/h4-15,32H,3H2,1-2H3,(H,33,36) |
| InChIKey | AFFRGNVVGKXYJM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|