C69H49N5 — CID 122427611
4-[4-[3,5-bis[4-(9,9-dimethylfluoren-3-yl)phenyl]phenyl]-6-quinolin-4-yl-1,3,5-triazin-2-yl]quinoline (PubChem CID 122427611) has the molecular formula C69H49N5 and a molecular weight of 948.19 g/mol. Its IUPAC name is 4-[4-[3,5-bis[4-(9,9-dimethylfluoren-3-yl)phenyl]phenyl]-6-quinolin-4-yl-1,3,5-triazin-2-yl]quinoline.
| Compound Name | 4-[4-[3,5-bis[4-(9,9-dimethylfluoren-3-yl)phenyl]phenyl]-6-quinolin-4-yl-1,3,5-triazin-2-yl]quinoline |
|---|---|
| PubChem CID | 122427611 |
| Molecular Formula | C69H49N5 |
| Molecular Weight | 948.19 g/mol |
| Exact Mass | 947.40 |
| IUPAC Name | 4-[4-[3,5-bis[4-(9,9-dimethylfluoren-3-yl)phenyl]phenyl]-6-quinolin-4-yl-1,3,5-triazin-2-yl]quinoline |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccc(-c4cc(-c5ccc(-c6ccc7c(c6)-c6ccccc6C7(C)C)cc5)cc(-c5nc(-c6ccnc7ccccc67)nc(-c6ccnc7ccccc67)n5)c4)cc3)ccc21 |
| InChI | InChI=1S/C69H49N5/c1-68(2)59-17-9-5-13-51(59)57-40-46(29-31-61(57)68)42-21-25-44(26-22-42)48-37-49(45-27-23-43(24-28-45)47-30-32-62-58(41-47)52-14-6-10-18-60(52)69(62,3)4)39-50(38-48)65-72-66(55-33-35-70-63-19-11-7-15-53(55)63)74-67(73-65)56-34-36-71-64-20-12-8-16-54(56)64/h5-41H,1-4H3 |
| InChIKey | YQCTYHFNIUCLRQ-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.19 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |