C46H45N3Si2 — CID 177088090
[4-[4-[3-(9,9-dimethylfluoren-3-yl)naphthalen-1-yl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177088090) has the molecular formula C46H45N3Si2 and a molecular weight of 696.06 g/mol. Its IUPAC name is [4-[4-[3-(9,9-dimethylfluoren-3-yl)naphthalen-1-yl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[3-(9,9-dimethylfluoren-3-yl)naphthalen-1-yl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088090 |
| Molecular Formula | C46H45N3Si2 |
| Molecular Weight | 696.06 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | [4-[4-[3-(9,9-dimethylfluoren-3-yl)naphthalen-1-yl]-6-(4-trimethylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cc(-c4nc(-c5ccc([Si](C)(C)C)cc5)nc(-c5ccc([Si](C)(C)C)cc5)n4)c4ccccc4c3)ccc21 |
| InChI | InChI=1S/C46H45N3Si2/c1-46(2)41-16-12-11-15-38(41)39-28-32(21-26-42(39)46)34-27-33-13-9-10-14-37(33)40(29-34)45-48-43(30-17-22-35(23-18-30)50(3,4)5)47-44(49-45)31-19-24-36(25-20-31)51(6,7)8/h9-29H,1-8H3 |
| InChIKey | GDBFTMHFMAOODE-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.06 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|