C45H37N3SSi — CID 177088299
[4-[4-dibenzothiophen-3-yl-6-[3-(9,9-dimethylfluoren-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177088299) has the molecular formula C45H37N3SSi and a molecular weight of 679.97 g/mol. Its IUPAC name is [4-[4-dibenzothiophen-3-yl-6-[3-(9,9-dimethylfluoren-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-dibenzothiophen-3-yl-6-[3-(9,9-dimethylfluoren-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088299 |
| Molecular Formula | C45H37N3SSi |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.25 |
| IUPAC Name | [4-[4-dibenzothiophen-3-yl-6-[3-(9,9-dimethylfluoren-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4nc(-c5ccc([Si](C)(C)C)cc5)nc(-c5ccc6c(c5)sc5ccccc56)n4)c3)cc21 |
| InChI | InChI=1S/C45H37N3SSi/c1-45(2)38-15-8-6-13-34(38)35-23-19-30(26-39(35)45)29-11-10-12-31(25-29)43-46-42(28-17-21-33(22-18-28)50(3,4)5)47-44(48-43)32-20-24-37-36-14-7-9-16-40(36)49-41(37)27-32/h6-27H,1-5H3 |
| InChIKey | VNIIXYXSGSEPKN-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|