C35H31N3O2 — CID 122429821
ethyl 3-(2-methyl-4-pyridinyl)-1-trityl-2,3-dihydroindazole-5-carboxylate (PubChem CID 122429821) has the molecular formula C35H31N3O2 and a molecular weight of 525.65 g/mol. Its IUPAC name is ethyl 3-(2-methyl-4-pyridinyl)-1-trityl-2,3-dihydroindazole-5-carboxylate.
| Compound Name | ethyl 3-(2-methyl-4-pyridinyl)-1-trityl-2,3-dihydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 122429821 |
| Molecular Formula | C35H31N3O2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | ethyl 3-(2-methyl-4-pyridinyl)-1-trityl-2,3-dihydroindazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(c1ccnc(C)c1)NN2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H31N3O2/c1-3-40-34(39)27-19-20-32-31(24-27)33(26-21-22-36-25(2)23-26)37-38(32)35(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-24,33,37H,3H2,1-2H3 |
| InChIKey | UBXFJMRBBUQOAX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|