C21H15F4N — CID 122431595
9-[3-fluoro-2-(trifluoromethyl)phenyl]-3,6-dimethylcarbazole (PubChem CID 122431595) has the molecular formula C21H15F4N and a molecular weight of 357.35 g/mol. Its IUPAC name is 9-[3-fluoro-2-(trifluoromethyl)phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[3-fluoro-2-(trifluoromethyl)phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 122431595 |
| Molecular Formula | C21H15F4N |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 9-[3-fluoro-2-(trifluoromethyl)phenyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cccc(F)c1C(F)(F)F |
| InChI | InChI=1S/C21H15F4N/c1-12-6-8-17-14(10-12)15-11-13(2)7-9-18(15)26(17)19-5-3-4-16(22)20(19)21(23,24)25/h3-11H,1-2H3 |
| InChIKey | BXCXDSQXWJMJLO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |