About 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole
3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole (PubChem CID 146656308) has the molecular formula C20H14F3N
and a molecular weight of 325.33 g/mol. Its IUPAC name is 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole.
Molecular Properties
| Compound Name | 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole |
| PubChem CID | 146656308 |
| Molecular Formula | C20H14F3N |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H14F3N/c1-11-3-6-16-13(9-11)14-10-12(2)4-7-17(14)24(16)18-8-5-15(21)19(22)20(18)23/h3-10H,1-2H3 |
| InChIKey | XZSWBGWXXFFYMD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole?
The IUPAC name of 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole (CID 146656308) is 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole.
What is the SMILES notation for 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole?
The canonical SMILES for 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole is Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(F)c(F)c1F.
What is the InChIKey of 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole?
The InChIKey is XZSWBGWXXFFYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N/c1-11-3-6-16-13(9-11)14-10-12(2)4-7-17(14)24(16)18-8-5-15(21)19(22)20(18)23/h3-10H,1-2H3.
What are the key properties of 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole?
3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole has a molecular weight of 325.33 g/mol, XLogP of 5.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-9-(2,3,4-trifluorophenyl)carbazole is sourced from PubChem (CID 146656308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).