C21H15F4N — CID 146656334
1-fluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole (PubChem CID 146656334) has the molecular formula C21H15F4N and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-fluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole.
| Compound Name | 1-fluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole |
|---|---|
| PubChem CID | 146656334 |
| Molecular Formula | C21H15F4N |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-fluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)cc(F)c1n2-c1cc(F)c(C)c(F)c1F |
| InChI | InChI=1S/C21H15F4N/c1-10-4-5-17-13(6-10)14-7-11(2)8-16(23)21(14)26(17)18-9-15(22)12(3)19(24)20(18)25/h4-9H,1-3H3 |
| InChIKey | RMFACEFMCDIVPN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|