C18H15N3O — CID 122433178
(2S)-1-dibenzofuran-3-yl-2,3-dimethyl-2H-imidazole-4-carbonitrile (PubChem CID 122433178) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is (2S)-1-dibenzofuran-3-yl-2,3-dimethyl-2H-imidazole-4-carbonitrile.
| Compound Name | (2S)-1-dibenzofuran-3-yl-2,3-dimethyl-2H-imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 122433178 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (2S)-1-dibenzofuran-3-yl-2,3-dimethyl-2H-imidazole-4-carbonitrile |
| SMILES | C[C@H]1N(C)C(C#N)=CN1c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C18H15N3O/c1-12-20(2)14(10-19)11-21(12)13-7-8-16-15-5-3-4-6-17(15)22-18(16)9-13/h3-9,11-12H,1-2H3/t12-/m0/s1 |
| InChIKey | OXRDCTASLUAKDC-LBPRGKRZSA-N |
| XLogP | 4.05 |
| TPSA | 43.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |