C21H21BrFN3O2 — CID 122434923
(E)-1-[4-(4-acetylanilino)piperazin-1-yl]-3-(4-bromo-2-fluorophenyl)prop-2-en-1-one (PubChem CID 122434923) has the molecular formula C21H21BrFN3O2 and a molecular weight of 446.32 g/mol. Its IUPAC name is (E)-1-[4-(4-acetylanilino)piperazin-1-yl]-3-(4-bromo-2-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-acetylanilino)piperazin-1-yl]-3-(4-bromo-2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122434923 |
| Molecular Formula | C21H21BrFN3O2 |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (E)-1-[4-(4-acetylanilino)piperazin-1-yl]-3-(4-bromo-2-fluorophenyl)prop-2-en-1-one |
| SMILES | CC(=O)c1ccc(NN2CCN(C(=O)/C=C/c3ccc(Br)cc3F)CC2)cc1 |
| InChI | InChI=1S/C21H21BrFN3O2/c1-15(27)16-3-7-19(8-4-16)24-26-12-10-25(11-13-26)21(28)9-5-17-2-6-18(22)14-20(17)23/h2-9,14,24H,10-13H2,1H3/b9-5+ |
| InChIKey | GOTQUBAQOXQHJK-WEVVVXLNSA-N |
| XLogP | 3.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|