C19H24N2O4 — CID 122439211
10-(cyclohexanecarbonyl)-N-hydroxy-2-oxa-10-azatricyclo[9.1.1.03,8]trideca-3(8),4,6-triene-6-carboxamide (PubChem CID 122439211) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 10-(cyclohexanecarbonyl)-N-hydroxy-2-oxa-10-azatricyclo[9.1.1.03,8]trideca-3(8),4,6-triene-6-carboxamide.
| Compound Name | 10-(cyclohexanecarbonyl)-N-hydroxy-2-oxa-10-azatricyclo[9.1.1.03,8]trideca-3(8),4,6-triene-6-carboxamide |
|---|---|
| PubChem CID | 122439211 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 10-(cyclohexanecarbonyl)-N-hydroxy-2-oxa-10-azatricyclo[9.1.1.03,8]trideca-3(8),4,6-triene-6-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CN(C(=O)C1CCCCC1)C1CC(C1)O2 |
| InChI | InChI=1S/C19H24N2O4/c22-18(20-24)13-6-7-17-14(8-13)11-21(15-9-16(10-15)25-17)19(23)12-4-2-1-3-5-12/h6-8,12,15-16,24H,1-5,9-11H2,(H,20,22) |
| InChIKey | UITUDXZJFZUQTC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|