C23H25FN2O5 — CID 122439459
3-(3-fluorophenyl)-N-hydroxy-4-(4-methyloxane-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122439459) has the molecular formula C23H25FN2O5 and a molecular weight of 428.46 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-hydroxy-4-(4-methyloxane-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-hydroxy-4-(4-methyloxane-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122439459 |
| Molecular Formula | C23H25FN2O5 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-hydroxy-4-(4-methyloxane-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC1(C(=O)N2Cc3ccc(C(=O)NO)cc3OCC2c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C23H25FN2O5/c1-23(7-9-30-10-8-23)22(28)26-13-17-6-5-16(21(27)25-29)12-20(17)31-14-19(26)15-3-2-4-18(24)11-15/h2-6,11-12,19,29H,7-10,13-14H2,1H3,(H,25,27) |
| InChIKey | DIXZXCJVVDIDPP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|