C24H25F3N2O5 — CID 122439509
N-hydroxy-4-(4-methyloxane-4-carbonyl)-3-[2-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122439509) has the molecular formula C24H25F3N2O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-hydroxy-4-(4-methyloxane-4-carbonyl)-3-[2-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | N-hydroxy-4-(4-methyloxane-4-carbonyl)-3-[2-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122439509 |
| Molecular Formula | C24H25F3N2O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-hydroxy-4-(4-methyloxane-4-carbonyl)-3-[2-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC1(C(=O)N2Cc3ccc(C(=O)NO)cc3OCC2c2ccccc2C(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C24H25F3N2O5/c1-23(8-10-33-11-9-23)22(31)29-13-16-7-6-15(21(30)28-32)12-20(16)34-14-19(29)17-4-2-3-5-18(17)24(25,26)27/h2-7,12,19,32H,8-11,13-14H2,1H3,(H,28,30) |
| InChIKey | HNKYBARGADQTIW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|