C19H26N2O4 — CID 122440505
(2R)-N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122440505) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | (2R)-N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122440505 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2R)-N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC(C)[C@@H]1CN(C(=O)C2(C)CCC2)Cc2ccc(C(=O)NO)cc2O1 |
| InChI | InChI=1S/C19H26N2O4/c1-12(2)16-11-21(18(23)19(3)7-4-8-19)10-14-6-5-13(17(22)20-24)9-15(14)25-16/h5-6,9,12,16,24H,4,7-8,10-11H2,1-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | DLYLYEZZBRSSJT-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|