C22H24N2O4 — CID 122440104
N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122440104) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122440104 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-hydroxy-4-(1-methylcyclobutanecarbonyl)-2-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC1(C(=O)N2Cc3ccc(C(=O)NO)cc3OC(c3ccccc3)C2)CCC1 |
| InChI | InChI=1S/C22H24N2O4/c1-22(10-5-11-22)21(26)24-13-17-9-8-16(20(25)23-27)12-18(17)28-19(14-24)15-6-3-2-4-7-15/h2-4,6-9,12,19,27H,5,10-11,13-14H2,1H3,(H,23,25) |
| InChIKey | UKTYEGUMMSUDHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|