C9H12BrN3O2S — CID 122442157
ethyl 2-amino-4-(bromomethyl)-6-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 122442157) has the molecular formula C9H12BrN3O2S and a molecular weight of 306.19 g/mol. Its IUPAC name is ethyl 2-amino-4-(bromomethyl)-6-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-(bromomethyl)-6-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 122442157 |
| Molecular Formula | C9H12BrN3O2S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | ethyl 2-amino-4-(bromomethyl)-6-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(CBr)nc(N)nc1SC |
| InChI | InChI=1S/C9H12BrN3O2S/c1-3-15-8(14)6-5(4-10)12-9(11)13-7(6)16-2/h3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | CXONPYJIJLJKTP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|